C14H21NO6 — CID 103201867
4-(3,3-diethoxypropoxy)-1-methoxy-2-nitrobenzene (PubChem CID 103201867) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 4-(3,3-diethoxypropoxy)-1-methoxy-2-nitrobenzene.
| Compound Name | 4-(3,3-diethoxypropoxy)-1-methoxy-2-nitrobenzene |
|---|---|
| PubChem CID | 103201867 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-(3,3-diethoxypropoxy)-1-methoxy-2-nitrobenzene |
| SMILES | CCOC(CCOc1ccc(OC)c([N+](=O)[O-])c1)OCC |
| InChI | InChI=1S/C14H21NO6/c1-4-19-14(20-5-2)8-9-21-11-6-7-13(18-3)12(10-11)15(16)17/h6-7,10,14H,4-5,8-9H2,1-3H3 |
| InChIKey | ZTONBJJZAGQYMG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|