C11H16N2O7S — CID 103202309
2-[2-(4-methoxy-3-nitrophenoxy)ethoxy]ethanesulfonamide (PubChem CID 103202309) has the molecular formula C11H16N2O7S and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[2-(4-methoxy-3-nitrophenoxy)ethoxy]ethanesulfonamide.
| Compound Name | 2-[2-(4-methoxy-3-nitrophenoxy)ethoxy]ethanesulfonamide |
|---|---|
| PubChem CID | 103202309 |
| Molecular Formula | C11H16N2O7S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[2-(4-methoxy-3-nitrophenoxy)ethoxy]ethanesulfonamide |
| SMILES | COc1ccc(OCCOCCS(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O7S/c1-18-11-3-2-9(8-10(11)13(14)15)20-5-4-19-6-7-21(12,16)17/h2-3,8H,4-7H2,1H3,(H2,12,16,17) |
| InChIKey | NMUZEVXMXHSKRM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|