C9H8Br2O3 — CID 79404227
2-(2,5-dibromo-4-methoxyphenoxy)acetaldehyde (PubChem CID 79404227) has the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. Its IUPAC name is 2-(2,5-dibromo-4-methoxyphenoxy)acetaldehyde.
| Compound Name | 2-(2,5-dibromo-4-methoxyphenoxy)acetaldehyde |
|---|---|
| PubChem CID | 79404227 |
| Molecular Formula | C9H8Br2O3 |
| Molecular Weight | 323.97 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | 2-(2,5-dibromo-4-methoxyphenoxy)acetaldehyde |
| SMILES | COc1cc(Br)c(OCC=O)cc1Br |
| InChI | InChI=1S/C9H8Br2O3/c1-13-8-4-7(11)9(5-6(8)10)14-3-2-12/h2,4-5H,3H2,1H3 |
| InChIKey | AUWXKHLSFAMDNF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.97 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|