C9H9Br2ClO2 — CID 11233233
1,4-dibromo-2-(2-chloroethoxy)-5-methoxybenzene (PubChem CID 11233233) has the molecular formula C9H9Br2ClO2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 1,4-dibromo-2-(2-chloroethoxy)-5-methoxybenzene.
| Compound Name | 1,4-dibromo-2-(2-chloroethoxy)-5-methoxybenzene |
|---|---|
| PubChem CID | 11233233 |
| Molecular Formula | C9H9Br2ClO2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 341.87 |
| IUPAC Name | 1,4-dibromo-2-(2-chloroethoxy)-5-methoxybenzene |
| SMILES | COc1cc(Br)c(OCCCl)cc1Br |
| InChI | InChI=1S/C9H9Br2ClO2/c1-13-8-4-7(11)9(5-6(8)10)14-3-2-12/h4-5H,2-3H2,1H3 |
| InChIKey | HTVPBTWCGJEGRJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|