C12H16Br2N2O3 — CID 79404299
5-(2,5-dibromo-4-methoxyphenoxy)-N'-hydroxypentanimidamide (PubChem CID 79404299) has the molecular formula C12H16Br2N2O3 and a molecular weight of 396.08 g/mol. Its IUPAC name is 5-(2,5-dibromo-4-methoxyphenoxy)-N'-hydroxypentanimidamide.
| Compound Name | 5-(2,5-dibromo-4-methoxyphenoxy)-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 79404299 |
| Molecular Formula | C12H16Br2N2O3 |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | 5-(2,5-dibromo-4-methoxyphenoxy)-N'-hydroxypentanimidamide |
| SMILES | COc1cc(Br)c(OCCCCC(N)=NO)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O3/c1-18-10-6-9(14)11(7-8(10)13)19-5-3-2-4-12(15)16-17/h6-7,17H,2-5H2,1H3,(H2,15,16) |
| InChIKey | MTLWCHJAQAGSLS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|