C7H5Br2ClO — CID 50997851
1,4-dibromo-2-chloro-5-methoxybenzene (PubChem CID 50997851) has the molecular formula C7H5Br2ClO and a molecular weight of 300.38 g/mol. Its IUPAC name is 1,4-dibromo-2-chloro-5-methoxybenzene.
| Compound Name | 1,4-dibromo-2-chloro-5-methoxybenzene |
|---|---|
| PubChem CID | 50997851 |
| Molecular Formula | C7H5Br2ClO |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 297.84 |
| IUPAC Name | 1,4-dibromo-2-chloro-5-methoxybenzene |
| SMILES | COc1cc(Br)c(Cl)cc1Br |
| InChI | InChI=1S/C7H5Br2ClO/c1-11-7-3-4(8)6(10)2-5(7)9/h2-3H,1H3 |
| InChIKey | LETNTRISWOPNKQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|