C7H4Br3ClO — CID 169336784
1,3,4-tribromo-2-chloro-5-methoxybenzene (PubChem CID 169336784) has the molecular formula C7H4Br3ClO and a molecular weight of 379.27 g/mol. Its IUPAC name is 1,3,4-tribromo-2-chloro-5-methoxybenzene.
| Compound Name | 1,3,4-tribromo-2-chloro-5-methoxybenzene |
|---|---|
| PubChem CID | 169336784 |
| Molecular Formula | C7H4Br3ClO |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 375.75 |
| IUPAC Name | 1,3,4-tribromo-2-chloro-5-methoxybenzene |
| SMILES | COc1cc(Br)c(Cl)c(Br)c1Br |
| InChI | InChI=1S/C7H4Br3ClO/c1-12-4-2-3(8)7(11)6(10)5(4)9/h2H,1H3 |
| InChIKey | ZPXOKYIBUMEVHD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|