C8H8Br2OS — CID 74891357
2,5-dibromo-1-methoxy-3-methylsulfanylbenzene (PubChem CID 74891357) has the molecular formula C8H8Br2OS and a molecular weight of 312.03 g/mol. Its IUPAC name is 2,5-dibromo-1-methoxy-3-methylsulfanylbenzene.
| Compound Name | 2,5-dibromo-1-methoxy-3-methylsulfanylbenzene |
|---|---|
| PubChem CID | 74891357 |
| Molecular Formula | C8H8Br2OS |
| Molecular Weight | 312.03 g/mol |
| Exact Mass | 309.87 |
| IUPAC Name | 2,5-dibromo-1-methoxy-3-methylsulfanylbenzene |
| SMILES | COc1cc(Br)cc(SC)c1Br |
| InChI | InChI=1S/C8H8Br2OS/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4H,1-2H3 |
| InChIKey | WRECEHQGYBWLJI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.03 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |