C9H13BrMgO3 — CID 173037834
magnesium;5-bromo-1,2,3-trimethoxybenzene;hydride (PubChem CID 173037834) has the molecular formula C9H13BrMgO3 and a molecular weight of 273.41 g/mol. Its IUPAC name is magnesium;5-bromo-1,2,3-trimethoxybenzene;hydride.
| Compound Name | magnesium;5-bromo-1,2,3-trimethoxybenzene;hydride |
|---|---|
| PubChem CID | 173037834 |
| Molecular Formula | C9H13BrMgO3 |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | magnesium;5-bromo-1,2,3-trimethoxybenzene;hydride |
| SMILES | COc1cc(Br)cc(OC)c1OC.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C9H11BrO3.Mg.2H/c1-11-7-4-6(10)5-8(12-2)9(7)13-3;;;/h4-5H,1-3H3;;;/q;+2;2*-1 |
| InChIKey | SLESYLOSFHNGMP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |