C7H5B2BrO — CID 89073638
CID 89073638 (PubChem CID 89073638) has the molecular formula C7H5B2BrO and a molecular weight of 206.64 g/mol.
| Compound Name | CID 89073638 |
|---|---|
| PubChem CID | 89073638 |
| Molecular Formula | C7H5B2BrO |
| Molecular Weight | 206.64 g/mol |
| Exact Mass | 205.97 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Br)cc([B])c1OC |
| InChI | InChI=1S/C7H5B2BrO/c1-11-7-5(8)2-4(10)3-6(7)9/h2-3H,1H3 |
| InChIKey | PQOHJTPKQVRWHT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.64 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|