C17H17BrO — CID 15474853
6-bromo-16-methoxytricyclo[9.2.2.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene (PubChem CID 15474853) has the molecular formula C17H17BrO and a molecular weight of 317.23 g/mol. Its IUPAC name is 6-bromo-16-methoxytricyclo[9.2.2.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene.
| Compound Name | 6-bromo-16-methoxytricyclo[9.2.2.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
|---|---|
| PubChem CID | 15474853 |
| Molecular Formula | C17H17BrO |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 6-bromo-16-methoxytricyclo[9.2.2.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
| SMILES | COc1c2cc(Br)cc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C17H17BrO/c1-19-17-14-8-6-12-2-3-13(5-4-12)7-9-15(17)11-16(18)10-14/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | SBCOVTJWQNEITB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |