C21H25BrO — CID 10339292
12-bromo-6-tert-butyl-16-methoxytricyclo[9.2.2.14,8]hexadeca-1(13),4(16),5,7,11,14-hexaene (PubChem CID 10339292) has the molecular formula C21H25BrO and a molecular weight of 373.33 g/mol. Its IUPAC name is 12-bromo-6-tert-butyl-16-methoxytricyclo[9.2.2.14,8]hexadeca-1(13),4(16),5,7,11,14-hexaene.
| Compound Name | 12-bromo-6-tert-butyl-16-methoxytricyclo[9.2.2.14,8]hexadeca-1(13),4(16),5,7,11,14-hexaene |
|---|---|
| PubChem CID | 10339292 |
| Molecular Formula | C21H25BrO |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 12-bromo-6-tert-butyl-16-methoxytricyclo[9.2.2.14,8]hexadeca-1(13),4(16),5,7,11,14-hexaene |
| SMILES | COc1c2cc(C(C)(C)C)cc1CCc1ccc(cc1Br)CC2 |
| InChI | InChI=1S/C21H25BrO/c1-21(2,3)18-12-16-8-6-14-5-7-15(19(22)11-14)9-10-17(13-18)20(16)23-4/h5,7,11-13H,6,8-10H2,1-4H3 |
| InChIKey | LHTIHEAFROFACW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |