C34H50Br2O2 — CID 11193080
(2S,3R)-2,3-dibromo-6,21-ditert-butyl-23,24-dimethoxytricyclo[17.3.1.14,8]tetracosa-1(22),4,6,8(24),19(23),20-hexaene (PubChem CID 11193080) has the molecular formula C34H50Br2O2 and a molecular weight of 650.58 g/mol. Its IUPAC name is (2S,3R)-2,3-dibromo-6,21-ditert-butyl-23,24-dimethoxytricyclo[17.3.1.14,8]tetracosa-1(22),4,6,8(24),19(23),20-hexaene.
| Compound Name | (2S,3R)-2,3-dibromo-6,21-ditert-butyl-23,24-dimethoxytricyclo[17.3.1.14,8]tetracosa-1(22),4,6,8(24),19(23),20-hexaene |
|---|---|
| PubChem CID | 11193080 |
| Molecular Formula | C34H50Br2O2 |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | (2S,3R)-2,3-dibromo-6,21-ditert-butyl-23,24-dimethoxytricyclo[17.3.1.14,8]tetracosa-1(22),4,6,8(24),19(23),20-hexaene |
| SMILES | COc1c2cc(C(C)(C)C)cc1[C@@H](Br)[C@@H](Br)c1cc(C(C)(C)C)cc(c1OC)CCCCCCCCCC2 |
| InChI | InChI=1S/C34H50Br2O2/c1-33(2,3)25-19-23-17-15-13-11-9-10-12-14-16-18-24-20-26(34(4,5)6)22-28(32(24)38-8)30(36)29(35)27(21-25)31(23)37-7/h19-22,29-30H,9-18H2,1-8H3/t29-,30+ |
| InChIKey | VEZMLFQZKRAQLL-RNPORBBMSA-N |
| XLogP | 11.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|