C54H76O4 — CID 11029125
(2S,14S)-2,5,11,14,17,23-hexatert-butyl-26,28-dimethoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9(27),10,12,15,17,19(26),21(25),22-dodecaene-25,27-diol (PubChem CID 11029125) has the molecular formula C54H76O4 and a molecular weight of 789.20 g/mol. Its IUPAC name is (2S,14S)-2,5,11,14,17,23-hexatert-butyl-26,28-dimethoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9(27),10,12,15,17,19(26),21(25),22-dodecaene-25,27-diol.
| Compound Name | (2S,14S)-2,5,11,14,17,23-hexatert-butyl-26,28-dimethoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9(27),10,12,15,17,19(26),21(25),22-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 11029125 |
| Molecular Formula | C54H76O4 |
| Molecular Weight | 789.20 g/mol |
| Exact Mass | 788.57 |
| IUPAC Name | (2S,14S)-2,5,11,14,17,23-hexatert-butyl-26,28-dimethoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9(27),10,12,15,17,19(26),21(25),22-dodecaene-25,27-diol |
| SMILES | COc1c2cc(C(C)(C)C)cc1[C@@H](C(C)(C)C)c1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1OC)[C@@H](C(C)(C)C)c1cc(C(C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C54H76O4/c1-49(2,3)35-23-31-21-33-25-37(51(7,8)9)30-42(47(33)57-19)44(54(16,17)18)40-28-36(50(4,5)6)24-32(46(40)56)22-34-26-38(52(10,11)12)29-41(48(34)58-20)43(53(13,14)15)39(27-35)45(31)55/h23-30,43-44,55-56H,21-22H2,1-20H3/t43-,44-/m0/s1 |
| InChIKey | YWDUYKKKTBPTIF-CXNSMIOJSA-N |
| XLogP | 14.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.20 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |