C46H56O5 — CID 53469366
8,14,20,26-tetratert-butyl-29,30-dihydroxy-28-methoxy-4-oxahexacyclo[22.3.1.112,16.118,22.02,6.05,10]triaconta-1(27),5(10),6,8,12,14,16(30),18(29),19,21,24(28),25-dodecaen-3-one (PubChem CID 53469366) has the molecular formula C46H56O5 and a molecular weight of 688.95 g/mol. Its IUPAC name is 8,14,20,26-tetratert-butyl-29,30-dihydroxy-28-methoxy-4-oxahexacyclo[22.3.1.112,16.118,22.02,6.05,10]triaconta-1(27),5(10),6,8,12,14,16(30),18(29),19,21,24(28),25-dodecaen-3-one.
| Compound Name | 8,14,20,26-tetratert-butyl-29,30-dihydroxy-28-methoxy-4-oxahexacyclo[22.3.1.112,16.118,22.02,6.05,10]triaconta-1(27),5(10),6,8,12,14,16(30),18(29),19,21,24(28),25-dodecaen-3-one |
|---|---|
| PubChem CID | 53469366 |
| Molecular Formula | C46H56O5 |
| Molecular Weight | 688.95 g/mol |
| Exact Mass | 688.41 |
| IUPAC Name | 8,14,20,26-tetratert-butyl-29,30-dihydroxy-28-methoxy-4-oxahexacyclo[22.3.1.112,16.118,22.02,6.05,10]triaconta-1(27),5(10),6,8,12,14,16(30),18(29),19,21,24(28),25-dodecaen-3-one |
| SMILES | COc1c2cc(C(C)(C)C)cc1C1C(=O)Oc3c(cc(C(C)(C)C)cc31)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C46H56O5/c1-43(2,3)31-17-25-14-26-18-32(44(4,5)6)20-28(39(26)48)16-30-22-34(46(10,11)12)24-36-37(42(49)51-41(30)36)35-23-33(45(7,8)9)21-29(40(35)50-13)15-27(19-31)38(25)47/h17-24,37,47-48H,14-16H2,1-13H3 |
| InChIKey | JUZWYXZTMFITLH-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.95 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|