C53H71O6P — CID 137398584
5,7-ditert-butyl-3-[3,5-dimethyl-4-[(1,3,7,9-tetratert-butyl-11-oxo-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]-3H-1-benzofuran-2-one (PubChem CID 137398584) has the molecular formula C53H71O6P and a molecular weight of 835.12 g/mol. Its IUPAC name is 5,7-ditert-butyl-3-[3,5-dimethyl-4-[(1,3,7,9-tetratert-butyl-11-oxo-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]-3H-1-benzofuran-2-one.
| Compound Name | 5,7-ditert-butyl-3-[3,5-dimethyl-4-[(1,3,7,9-tetratert-butyl-11-oxo-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 137398584 |
| Molecular Formula | C53H71O6P |
| Molecular Weight | 835.12 g/mol |
| Exact Mass | 834.50 |
| IUPAC Name | 5,7-ditert-butyl-3-[3,5-dimethyl-4-[(1,3,7,9-tetratert-butyl-11-oxo-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]-3H-1-benzofuran-2-one |
| SMILES | Cc1cc(C2C(=O)Oc3c2cc(C(C)(C)C)cc3C(C)(C)C)cc(C)c1OP1(=O)Oc2c(cc(C(C)(C)C)cc2C(C)(C)C)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C53H71O6P/c1-30-21-32(42-38-26-37(50(9,10)11)29-41(53(18,19)20)46(38)56-47(42)54)22-31(2)43(30)57-60(55)58-44-33(24-35(48(3,4)5)27-39(44)51(12,13)14)23-34-25-36(49(6,7)8)28-40(45(34)59-60)52(15,16)17/h21-22,24-29,42H,23H2,1-20H3 |
| InChIKey | IXTAHNDRWKKIQD-UHFFFAOYSA-N |
| XLogP | 14.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.12 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|