C29H38O4 — CID 140997276
[4-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)-2,6-dimethylphenyl] pentanoate (PubChem CID 140997276) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is [4-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)-2,6-dimethylphenyl] pentanoate.
| Compound Name | [4-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)-2,6-dimethylphenyl] pentanoate |
|---|---|
| PubChem CID | 140997276 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | [4-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)-2,6-dimethylphenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1c(C)cc(C2C(=O)Oc3c2cc(C(C)(C)C)cc3C(C)(C)C)cc1C |
| InChI | InChI=1S/C29H38O4/c1-10-11-12-23(30)32-25-17(2)13-19(14-18(25)3)24-21-15-20(28(4,5)6)16-22(29(7,8)9)26(21)33-27(24)31/h13-16,24H,10-12H2,1-9H3 |
| InChIKey | RUSAFGGZMIEKBF-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|