C24H28O4 — CID 170555094
[4-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenyl] acetate (PubChem CID 170555094) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is [4-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenyl] acetate.
| Compound Name | [4-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenyl] acetate |
|---|---|
| PubChem CID | 170555094 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [4-(5,7-ditert-butyl-2-oxo-3H-1-benzofuran-3-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2C(=O)Oc3c2cc(C(C)(C)C)cc3C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H28O4/c1-14(25)27-17-10-8-15(9-11-17)20-18-12-16(23(2,3)4)13-19(24(5,6)7)21(18)28-22(20)26/h8-13,20H,1-7H3 |
| InChIKey | QHRSBRNBRMBQIN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|