C30H42O3 — CID 168735004
5,7-ditert-butyl-3-(4-octoxyphenyl)-3H-1-benzofuran-2-one (PubChem CID 168735004) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is 5,7-ditert-butyl-3-(4-octoxyphenyl)-3H-1-benzofuran-2-one.
| Compound Name | 5,7-ditert-butyl-3-(4-octoxyphenyl)-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 168735004 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 5,7-ditert-butyl-3-(4-octoxyphenyl)-3H-1-benzofuran-2-one |
| SMILES | CCCCCCCCOc1ccc(C2C(=O)Oc3c2cc(C(C)(C)C)cc3C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H42O3/c1-8-9-10-11-12-13-18-32-23-16-14-21(15-17-23)26-24-19-22(29(2,3)4)20-25(30(5,6)7)27(24)33-28(26)31/h14-17,19-20,26H,8-13,18H2,1-7H3 |
| InChIKey | WGOFQELESZHOCV-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|