C38H61O3P — CID 22709132
1,3,7,9-tetratert-butyl-5-methyl-11-octoxy-5H-benzo[d][1,3,2]benzodioxaphosphocine (PubChem CID 22709132) has the molecular formula C38H61O3P and a molecular weight of 596.88 g/mol. Its IUPAC name is 1,3,7,9-tetratert-butyl-5-methyl-11-octoxy-5H-benzo[d][1,3,2]benzodioxaphosphocine.
| Compound Name | 1,3,7,9-tetratert-butyl-5-methyl-11-octoxy-5H-benzo[d][1,3,2]benzodioxaphosphocine |
|---|---|
| PubChem CID | 22709132 |
| Molecular Formula | C38H61O3P |
| Molecular Weight | 596.88 g/mol |
| Exact Mass | 596.44 |
| IUPAC Name | 1,3,7,9-tetratert-butyl-5-methyl-11-octoxy-5H-benzo[d][1,3,2]benzodioxaphosphocine |
| SMILES | CCCCCCCCOP1Oc2c(cc(C(C)(C)C)cc2C(C)(C)C)C(C)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C38H61O3P/c1-15-16-17-18-19-20-21-39-42-40-33-29(22-27(35(3,4)5)24-31(33)37(9,10)11)26(2)30-23-28(36(6,7)8)25-32(34(30)41-42)38(12,13)14/h22-26H,15-21H2,1-14H3 |
| InChIKey | OSHXFEWLGVUTMR-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.88 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|