C37H61O3P — CID 162248631
octane;1,3,7,9-tetratert-butyl-11-hydroxy-5H-benzo[d][1,3,2]benzodioxaphosphocine (PubChem CID 162248631) has the molecular formula C37H61O3P and a molecular weight of 584.87 g/mol. Its IUPAC name is octane;1,3,7,9-tetratert-butyl-11-hydroxy-5H-benzo[d][1,3,2]benzodioxaphosphocine.
| Compound Name | octane;1,3,7,9-tetratert-butyl-11-hydroxy-5H-benzo[d][1,3,2]benzodioxaphosphocine |
|---|---|
| PubChem CID | 162248631 |
| Molecular Formula | C37H61O3P |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.44 |
| IUPAC Name | octane;1,3,7,9-tetratert-butyl-11-hydroxy-5H-benzo[d][1,3,2]benzodioxaphosphocine |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OP(O)Oc1c(cc(C(C)(C)C)cc1C(C)(C)C)C2.CCCCCCCC |
| InChI | InChI=1S/C29H43O3P.C8H18/c1-26(2,3)20-14-18-13-19-15-21(27(4,5)6)17-23(29(10,11)12)25(19)32-33(30)31-24(18)22(16-20)28(7,8)9;1-3-5-7-8-6-4-2/h14-17,30H,13H2,1-12H3;3-8H2,1-2H3 |
| InChIKey | ZXRKKAYEVCVQMD-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|