C52H73O4P — CID 139724522
2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(1,9-ditert-butyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]phenol (PubChem CID 139724522) has the molecular formula C52H73O4P and a molecular weight of 793.13 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(1,9-ditert-butyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(1,9-ditert-butyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 139724522 |
| Molecular Formula | C52H73O4P |
| Molecular Weight | 793.13 g/mol |
| Exact Mass | 792.52 |
| IUPAC Name | 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(1,9-ditert-butyl-3,7-dimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]phenol |
| SMILES | Cc1cc2c(c(C(C)(C)C)c1)OP(Oc1c(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3O)cc(C(C)(C)C)cc1C(C)(C)C)Oc1c(cc(C)cc1C(C)(C)C)C2 |
| InChI | InChI=1S/C52H73O4P/c1-31-21-34-26-35-22-32(2)24-41(51(15,16)17)45(35)55-57(54-44(34)40(23-31)50(12,13)14)56-46-36(28-38(48(6,7)8)30-42(46)52(18,19)20)25-33-27-37(47(3,4)5)29-39(43(33)53)49(9,10)11/h21-24,27-30,53H,25-26H2,1-20H3 |
| InChIKey | ZGQOMFKRWYDBEG-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.13 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|