C34H53O4P — CID 130306287
2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]phenyl]methyl]phenol (PubChem CID 130306287) has the molecular formula C34H53O4P and a molecular weight of 556.77 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]phenyl]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 130306287 |
| Molecular Formula | C34H53O4P |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)oxy]phenyl]methyl]phenol |
| SMILES | CC1(C)COP(Oc2c(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3O)cc(C(C)(C)C)cc2C(C)(C)C)OC1 |
| InChI | InChI=1S/C34H53O4P/c1-30(2,3)24-16-22(28(35)26(18-24)32(7,8)9)15-23-17-25(31(4,5)6)19-27(33(10,11)12)29(23)38-39-36-20-34(13,14)21-37-39/h16-19,35H,15,20-21H2,1-14H3 |
| InChIKey | ZDRVILHLANEVCD-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|