C59H87O4P — CID 139724523
2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(1,3,7,9-tetratert-butyl-5-methyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]phenol (PubChem CID 139724523) has the molecular formula C59H87O4P and a molecular weight of 891.31 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(1,3,7,9-tetratert-butyl-5-methyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(1,3,7,9-tetratert-butyl-5-methyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 139724523 |
| Molecular Formula | C59H87O4P |
| Molecular Weight | 891.31 g/mol |
| Exact Mass | 890.63 |
| IUPAC Name | 2,4-ditert-butyl-6-[[3,5-ditert-butyl-2-[(1,3,7,9-tetratert-butyl-5-methyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]phenol |
| SMILES | CC1c2cc(C(C)(C)C)cc(C(C)(C)C)c2OP(Oc2c(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3O)cc(C(C)(C)C)cc2C(C)(C)C)Oc2c1cc(C(C)(C)C)cc2C(C)(C)C |
| InChI | InChI=1S/C59H87O4P/c1-35-42-29-40(54(8,9)10)33-46(58(20,21)22)50(42)62-64(63-51-43(35)30-41(55(11,12)13)34-47(51)59(23,24)25)61-49-37(28-39(53(5,6)7)32-45(49)57(17,18)19)26-36-27-38(52(2,3)4)31-44(48(36)60)56(14,15)16/h27-35,60H,26H2,1-25H3 |
| InChIKey | DRRHVBMCROPTIJ-UHFFFAOYSA-N |
| XLogP | 17.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.31 |
| LogP ≤ 5 | 17.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|