C47H63O4P — CID 139724526
2-tert-butyl-6-[[3-tert-butyl-2-[(1,9-ditert-butyl-3,5,7-trimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]-5-methylphenyl]methyl]-4-methylphenol (PubChem CID 139724526) has the molecular formula C47H63O4P and a molecular weight of 722.99 g/mol. Its IUPAC name is 2-tert-butyl-6-[[3-tert-butyl-2-[(1,9-ditert-butyl-3,5,7-trimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]-5-methylphenyl]methyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[[3-tert-butyl-2-[(1,9-ditert-butyl-3,5,7-trimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]-5-methylphenyl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 139724526 |
| Molecular Formula | C47H63O4P |
| Molecular Weight | 722.99 g/mol |
| Exact Mass | 722.45 |
| IUPAC Name | 2-tert-butyl-6-[[3-tert-butyl-2-[(1,9-ditert-butyl-3,5,7-trimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]-5-methylphenyl]methyl]-4-methylphenol |
| SMILES | Cc1cc(Cc2cc(C)cc(C(C)(C)C)c2OP2Oc3c(cc(C)cc3C(C)(C)C)C(C)c3cc(C)cc(C(C)(C)C)c3O2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C47H63O4P/c1-27-18-32(40(48)36(22-27)44(6,7)8)26-33-19-28(2)23-37(45(9,10)11)41(33)49-52-50-42-34(20-29(3)24-38(42)46(12,13)14)31(5)35-21-30(4)25-39(43(35)51-52)47(15,16)17/h18-25,31,48H,26H2,1-17H3 |
| InChIKey | WFRLPTKNAXVSLY-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.99 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|