C53H75O5P — CID 139780892
2-tert-butyl-6-[[3-tert-butyl-5-methyl-2-[(1,3,7,9-tetratert-butyl-5-methyl-11-oxo-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]-4-methylphenol (PubChem CID 139780892) has the molecular formula C53H75O5P and a molecular weight of 823.15 g/mol. Its IUPAC name is 2-tert-butyl-6-[[3-tert-butyl-5-methyl-2-[(1,3,7,9-tetratert-butyl-5-methyl-11-oxo-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[[3-tert-butyl-5-methyl-2-[(1,3,7,9-tetratert-butyl-5-methyl-11-oxo-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 139780892 |
| Molecular Formula | C53H75O5P |
| Molecular Weight | 823.15 g/mol |
| Exact Mass | 822.54 |
| IUPAC Name | 2-tert-butyl-6-[[3-tert-butyl-5-methyl-2-[(1,3,7,9-tetratert-butyl-5-methyl-11-oxo-5H-benzo[d][1,3,2]benzodioxaphosphocin-11-yl)oxy]phenyl]methyl]-4-methylphenol |
| SMILES | Cc1cc(Cc2cc(C)cc(C(C)(C)C)c2OP2(=O)Oc3c(cc(C(C)(C)C)cc3C(C)(C)C)C(C)c3cc(C(C)(C)C)cc(C(C)(C)C)c3O2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C53H75O5P/c1-31-22-34(44(54)40(24-31)50(10,11)12)26-35-23-32(2)25-41(51(13,14)15)45(35)56-59(55)57-46-38(27-36(48(4,5)6)29-42(46)52(16,17)18)33(3)39-28-37(49(7,8)9)30-43(47(39)58-59)53(19,20)21/h22-25,27-30,33,54H,26H2,1-21H3 |
| InChIKey | XKKDZXQEUDGXCX-UHFFFAOYSA-N |
| XLogP | 15.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.15 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|