C60H88MgO8P2 — CID 22272209
magnesium bis(1,3,7,9-tetratert-butyl-5-methyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide) (PubChem CID 22272209) has the molecular formula C60H88MgO8P2 and a molecular weight of 1023.61 g/mol. Its IUPAC name is magnesium bis(1,3,7,9-tetratert-butyl-5-methyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide).
| Compound Name | magnesium bis(1,3,7,9-tetratert-butyl-5-methyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide) |
|---|---|
| PubChem CID | 22272209 |
| Molecular Formula | C60H88MgO8P2 |
| Molecular Weight | 1023.61 g/mol |
| Exact Mass | 1022.58 |
| IUPAC Name | magnesium bis(1,3,7,9-tetratert-butyl-5-methyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide) |
| SMILES | CC1c2cc(C(C)(C)C)cc(C(C)(C)C)c2OP(=O)([O-])Oc2c1cc(C(C)(C)C)cc2C(C)(C)C.CC1c2cc(C(C)(C)C)cc(C(C)(C)C)c2OP(=O)([O-])Oc2c1cc(C(C)(C)C)cc2C(C)(C)C.[Mg+2] |
| InChI | InChI=1S/2C30H45O4P.Mg/c2*1-18-21-14-19(27(2,3)4)16-23(29(8,9)10)25(21)33-35(31,32)34-26-22(18)15-20(28(5,6)7)17-24(26)30(11,12)13;/h2*14-18H,1-13H3,(H,31,32);/q;;+2/p-2 |
| InChIKey | FLFVLZVXIXISHV-UHFFFAOYSA-L |
| XLogP | 16.16 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.61 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|