C31H46NaO4P — CID 139878544
sodium 1,3,7,9-tetratert-butyl-4,6-dimethyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 139878544) has the molecular formula C31H46NaO4P and a molecular weight of 536.67 g/mol. Its IUPAC name is sodium 1,3,7,9-tetratert-butyl-4,6-dimethyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
| Compound Name | sodium 1,3,7,9-tetratert-butyl-4,6-dimethyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
|---|---|
| PubChem CID | 139878544 |
| Molecular Formula | C31H46NaO4P |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | sodium 1,3,7,9-tetratert-butyl-4,6-dimethyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | Cc1c(C(C)(C)C)cc(C(C)(C)C)c2c1Cc1c(C)c(C(C)(C)C)cc(C(C)(C)C)c1OP(=O)([O-])O2.[Na+] |
| InChI | InChI=1S/C31H47O4P.Na/c1-18-20-15-21-19(2)23(29(6,7)8)17-25(31(12,13)14)27(21)35-36(32,33)34-26(20)24(30(9,10)11)16-22(18)28(3,4)5;/h16-17H,15H2,1-14H3,(H,32,33);/q;+1/p-1 |
| InChIKey | HUDFDKBZNINDMF-UHFFFAOYSA-M |
| XLogP | 5.33 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|