C28H40AgO4P — CID 71573958
silver 2,4,8,10-tetratert-butyl-6-oxidobenzo[d][1,3,2]benzodioxaphosphepine 6-oxide (PubChem CID 71573958) has the molecular formula C28H40AgO4P and a molecular weight of 579.47 g/mol. Its IUPAC name is silver 2,4,8,10-tetratert-butyl-6-oxidobenzo[d][1,3,2]benzodioxaphosphepine 6-oxide.
| Compound Name | silver 2,4,8,10-tetratert-butyl-6-oxidobenzo[d][1,3,2]benzodioxaphosphepine 6-oxide |
|---|---|
| PubChem CID | 71573958 |
| Molecular Formula | C28H40AgO4P |
| Molecular Weight | 579.47 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | silver 2,4,8,10-tetratert-butyl-6-oxidobenzo[d][1,3,2]benzodioxaphosphepine 6-oxide |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OP(=O)([O-])Oc1c-2cc(C(C)(C)C)cc1C(C)(C)C.[Ag+] |
| InChI | InChI=1S/C28H41O4P.Ag/c1-25(2,3)17-13-19-20-14-18(26(4,5)6)16-22(28(10,11)12)24(20)32-33(29,30)31-23(19)21(15-17)27(7,8)9;/h13-16H,1-12H3,(H,29,30);/q;+1/p-1 |
| InChIKey | CYKJKAPOBZXWCE-UHFFFAOYSA-M |
| XLogP | 7.78 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.47 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|