About 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one
6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one (PubChem CID 43536433) has the molecular formula C18H26O2
and a molecular weight of 274.40 g/mol. Its IUPAC name is 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one |
| PubChem CID | 43536433 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one |
| SMILES | CC1CC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C18H26O2/c1-11-8-15(19)13-9-12(17(2,3)4)10-14(16(13)20-11)18(5,6)7/h9-11H,8H2,1-7H3 |
| InChIKey | SZBKNILYILVAFX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one?
The IUPAC name of 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one (CID 43536433) is 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one is CC1CC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O1.
What is the InChIKey of 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one?
The InChIKey is SZBKNILYILVAFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O2/c1-11-8-15(19)13-9-12(17(2,3)4)10-14(16(13)20-11)18(5,6)7/h9-11H,8H2,1-7H3.
What are the key properties of 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one?
6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one has a molecular weight of 274.40 g/mol, XLogP of 4.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 43536433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).