C18H26O2 — CID 43536433
6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one (PubChem CID 43536433) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one.
| Compound Name | 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 43536433 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 6,8-ditert-butyl-2-methyl-2,3-dihydrochromen-4-one |
| SMILES | CC1CC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C18H26O2/c1-11-8-15(19)13-9-12(17(2,3)4)10-14(16(13)20-11)18(5,6)7/h9-11H,8H2,1-7H3 |
| InChIKey | SZBKNILYILVAFX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |