About spiro[3H-chromene-2,1'-cyclohexane]-4-one
spiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 11106781) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is spiro[3H-chromene-2,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| PubChem CID | 11106781 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | O=C1CC2(CCCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C14H16O2/c15-12-10-14(8-4-1-5-9-14)16-13-7-3-2-6-11(12)13/h2-3,6-7H,1,4-5,8-10H2 |
| InChIKey | DBQLMDVZSFDTRL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3H-chromene-2,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The IUPAC name of spiro[3H-chromene-2,1'-cyclohexane]-4-one (CID 11106781) is spiro[3H-chromene-2,1'-cyclohexane]-4-one.
What is the SMILES notation for spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The canonical SMILES for spiro[3H-chromene-2,1'-cyclohexane]-4-one is O=C1CC2(CCCCC2)Oc2ccccc21.
What is the InChIKey of spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The InChIKey is DBQLMDVZSFDTRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c15-12-10-14(8-4-1-5-9-14)16-13-7-3-2-6-11(12)13/h2-3,6-7H,1,4-5,8-10H2.
What are the key properties of spiro[3H-chromene-2,1'-cyclohexane]-4-one?
spiro[3H-chromene-2,1'-cyclohexane]-4-one has a molecular weight of 216.28 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-chromene-2,1'-cyclohexane]-4-one is sourced from PubChem (CID 11106781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).