C24H32LiO3P — CID 23716759
lithium 2,4,8-tritert-butyl-6-oxidobenzo[c][1,2]benzoxaphosphinine 6-oxide (PubChem CID 23716759) has the molecular formula C24H32LiO3P and a molecular weight of 406.43 g/mol. Its IUPAC name is lithium 2,4,8-tritert-butyl-6-oxidobenzo[c][1,2]benzoxaphosphinine 6-oxide.
| Compound Name | lithium 2,4,8-tritert-butyl-6-oxidobenzo[c][1,2]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 23716759 |
| Molecular Formula | C24H32LiO3P |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | lithium 2,4,8-tritert-butyl-6-oxidobenzo[c][1,2]benzoxaphosphinine 6-oxide |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OP(=O)([O-])c1cc(C(C)(C)C)ccc1-2.[Li+] |
| InChI | InChI=1S/C24H33O3P.Li/c1-22(2,3)15-10-11-17-18-12-16(23(4,5)6)13-19(24(7,8)9)21(18)27-28(25,26)20(17)14-15;/h10-14H,1-9H3,(H,25,26);/q;+1/p-1 |
| InChIKey | XWRGKNXYROCSOF-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|