C39H53P — CID 15821264
(2,7-ditert-butylfluoren-9-ylidene)-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 15821264) has the molecular formula C39H53P and a molecular weight of 552.83 g/mol. Its IUPAC name is (2,7-ditert-butylfluoren-9-ylidene)-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | (2,7-ditert-butylfluoren-9-ylidene)-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 15821264 |
| Molecular Formula | C39H53P |
| Molecular Weight | 552.83 g/mol |
| Exact Mass | 552.39 |
| IUPAC Name | (2,7-ditert-butylfluoren-9-ylidene)-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1ccc2c(c1)C(=Pc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C39H53P/c1-35(2,3)24-16-18-27-28-19-17-25(36(4,5)6)21-30(28)33(29(27)20-24)40-34-31(38(10,11)12)22-26(37(7,8)9)23-32(34)39(13,14)15/h16-23H,1-15H3 |
| InChIKey | YMLFAJILFRGKQR-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.83 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|