C24H34P2 — CID 13086218
phenyl-(2,4,6-tritert-butylphenyl)phosphanylidenephosphane (PubChem CID 13086218) has the molecular formula C24H34P2 and a molecular weight of 384.48 g/mol. Its IUPAC name is phenyl-(2,4,6-tritert-butylphenyl)phosphanylidenephosphane.
| Compound Name | phenyl-(2,4,6-tritert-butylphenyl)phosphanylidenephosphane |
|---|---|
| PubChem CID | 13086218 |
| Molecular Formula | C24H34P2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | phenyl-(2,4,6-tritert-butylphenyl)phosphanylidenephosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=P/c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H34P2/c1-22(2,3)17-15-19(23(4,5)6)21(20(16-17)24(7,8)9)26-25-18-13-11-10-12-14-18/h10-16H,1-9H3 |
| InChIKey | XMNWRQQQNSXCPA-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|