C25H35OOsP — CID 134984450
benzene;carbon monoxide;(2,4,6-tritert-butylphenyl)phosphanylideneosmium (PubChem CID 134984450) has the molecular formula C25H35OOsP and a molecular weight of 572.76 g/mol. Its IUPAC name is benzene;carbon monoxide;(2,4,6-tritert-butylphenyl)phosphanylideneosmium.
| Compound Name | benzene;carbon monoxide;(2,4,6-tritert-butylphenyl)phosphanylideneosmium |
|---|---|
| PubChem CID | 134984450 |
| Molecular Formula | C25H35OOsP |
| Molecular Weight | 572.76 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | benzene;carbon monoxide;(2,4,6-tritert-butylphenyl)phosphanylideneosmium |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(P=[Os])c(C(C)(C)C)c1.[C-]#[O+].c1ccccc1 |
| InChI | InChI=1S/C18H29P.C6H6.CO.Os/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9;1-2-4-6-5-3-1;1-2;/h10-11H,1-9H3;1-6H;; |
| InChIKey | PGRDYMWNCFLVNZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 19.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.76 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|