C31H39LiP2 — CID 177462809
lithium diphenyl-[(2,4,6-tritert-butylphenyl)phosphanylidenemethyl]phosphane (PubChem CID 177462809) has the molecular formula C31H39LiP2 and a molecular weight of 480.54 g/mol. Its IUPAC name is lithium diphenyl-[(2,4,6-tritert-butylphenyl)phosphanylidenemethyl]phosphane.
| Compound Name | lithium diphenyl-[(2,4,6-tritert-butylphenyl)phosphanylidenemethyl]phosphane |
|---|---|
| PubChem CID | 177462809 |
| Molecular Formula | C31H39LiP2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | lithium diphenyl-[(2,4,6-tritert-butylphenyl)phosphanylidenemethyl]phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=[C-]/P(c2ccccc2)c2ccccc2)c(C(C)(C)C)c1.[Li+] |
| InChI | InChI=1S/C31H39P2.Li/c1-29(2,3)23-20-26(30(4,5)6)28(27(21-23)31(7,8)9)32-22-33(24-16-12-10-13-17-24)25-18-14-11-15-19-25;/h10-21H,1-9H3;/q-1;+1 |
| InChIKey | XLGRLIRERFDEQW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|