C26H36BrP — CID 11431063
(1-bromo-2-phenylethylidene)-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 11431063) has the molecular formula C26H36BrP and a molecular weight of 459.45 g/mol. Its IUPAC name is (1-bromo-2-phenylethylidene)-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | (1-bromo-2-phenylethylidene)-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 11431063 |
| Molecular Formula | C26H36BrP |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (1-bromo-2-phenylethylidene)-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=C(\Br)Cc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H36BrP/c1-24(2,3)19-16-20(25(4,5)6)23(21(17-19)26(7,8)9)28-22(27)15-18-13-11-10-12-14-18/h10-14,16-17H,15H2,1-9H3 |
| InChIKey | YOIFEXRFQWJOFS-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|