C22H27ClO2 — CID 102210368
3,5-ditert-butyl-2-phenylmethoxybenzoyl chloride (PubChem CID 102210368) has the molecular formula C22H27ClO2 and a molecular weight of 358.91 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-phenylmethoxybenzoyl chloride.
| Compound Name | 3,5-ditert-butyl-2-phenylmethoxybenzoyl chloride |
|---|---|
| PubChem CID | 102210368 |
| Molecular Formula | C22H27ClO2 |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3,5-ditert-butyl-2-phenylmethoxybenzoyl chloride |
| SMILES | CC(C)(C)c1cc(C(=O)Cl)c(OCc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H27ClO2/c1-21(2,3)16-12-17(20(23)24)19(18(13-16)22(4,5)6)25-14-15-10-8-7-9-11-15/h7-13H,14H2,1-6H3 |
| InChIKey | CKMWEDOAJBCWBE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|