C38H53O2P — CID 71191512
1-[2-[3-(3,5-ditert-butyl-2-phenylmethoxyphenyl)octan-3-ylphosphanyl]-5-methylphenyl]ethanone (PubChem CID 71191512) has the molecular formula C38H53O2P and a molecular weight of 572.81 g/mol. Its IUPAC name is 1-[2-[3-(3,5-ditert-butyl-2-phenylmethoxyphenyl)octan-3-ylphosphanyl]-5-methylphenyl]ethanone.
| Compound Name | 1-[2-[3-(3,5-ditert-butyl-2-phenylmethoxyphenyl)octan-3-ylphosphanyl]-5-methylphenyl]ethanone |
|---|---|
| PubChem CID | 71191512 |
| Molecular Formula | C38H53O2P |
| Molecular Weight | 572.81 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | 1-[2-[3-(3,5-ditert-butyl-2-phenylmethoxyphenyl)octan-3-ylphosphanyl]-5-methylphenyl]ethanone |
| SMILES | CCCCCC(CC)(Pc1ccc(C)cc1C(C)=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C38H53O2P/c1-11-13-17-22-38(12-2,41-34-21-20-27(3)23-31(34)28(4)39)33-25-30(36(5,6)7)24-32(37(8,9)10)35(33)40-26-29-18-15-14-16-19-29/h14-16,18-21,23-25,41H,11-13,17,22,26H2,1-10H3 |
| InChIKey | DWEWZIOSXQBBBC-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.81 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|