C26H39OP — CID 71040219
3-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)heptan-3-yl-methylphosphane (PubChem CID 71040219) has the molecular formula C26H39OP and a molecular weight of 398.57 g/mol. Its IUPAC name is 3-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)heptan-3-yl-methylphosphane.
| Compound Name | 3-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)heptan-3-yl-methylphosphane |
|---|---|
| PubChem CID | 71040219 |
| Molecular Formula | C26H39OP |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 3-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)heptan-3-yl-methylphosphane |
| SMILES | CCCCC(CC)(PC)c1cc(C(C)(C)C)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H39OP/c1-8-10-16-26(9-2,28-7)23-18-22(25(4,5)6)17-20(3)24(23)27-19-21-14-12-11-13-15-21/h11-15,17-18,28H,8-10,16,19H2,1-7H3 |
| InChIKey | QDUIUPZCMQGKHX-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|