C32H42NOP — CID 70807359
1-[2-[2-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)pentan-2-ylphosphanyl]-5-methylphenyl]-N-methylmethanimine (PubChem CID 70807359) has the molecular formula C32H42NOP and a molecular weight of 487.67 g/mol. Its IUPAC name is 1-[2-[2-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)pentan-2-ylphosphanyl]-5-methylphenyl]-N-methylmethanimine.
| Compound Name | 1-[2-[2-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)pentan-2-ylphosphanyl]-5-methylphenyl]-N-methylmethanimine |
|---|---|
| PubChem CID | 70807359 |
| Molecular Formula | C32H42NOP |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 1-[2-[2-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)pentan-2-ylphosphanyl]-5-methylphenyl]-N-methylmethanimine |
| SMILES | CCCC(C)(Pc1ccc(C)cc1/C=N\C)c1cc(C(C)(C)C)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C32H42NOP/c1-9-17-32(7,35-29-16-15-23(2)18-26(29)21-33-8)28-20-27(31(4,5)6)19-24(3)30(28)34-22-25-13-11-10-12-14-25/h10-16,18-21,35H,9,17,22H2,1-8H3/b33-21- |
| InChIKey | RBBPMAMVFPOKCZ-HWIUFGAZSA-N |
| XLogP | 8.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|