C35H47O2P — CID 88968940
2-[2-(3,5-ditert-butyl-2-phenylmethoxyphenyl)hexan-2-ylphosphanyl]-5-methylbenzaldehyde (PubChem CID 88968940) has the molecular formula C35H47O2P and a molecular weight of 530.73 g/mol. Its IUPAC name is 2-[2-(3,5-ditert-butyl-2-phenylmethoxyphenyl)hexan-2-ylphosphanyl]-5-methylbenzaldehyde.
| Compound Name | 2-[2-(3,5-ditert-butyl-2-phenylmethoxyphenyl)hexan-2-ylphosphanyl]-5-methylbenzaldehyde |
|---|---|
| PubChem CID | 88968940 |
| Molecular Formula | C35H47O2P |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 2-[2-(3,5-ditert-butyl-2-phenylmethoxyphenyl)hexan-2-ylphosphanyl]-5-methylbenzaldehyde |
| SMILES | CCCCC(C)(Pc1ccc(C)cc1C=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C35H47O2P/c1-10-11-19-35(9,38-31-18-17-25(2)20-27(31)23-36)30-22-28(33(3,4)5)21-29(34(6,7)8)32(30)37-24-26-15-13-12-14-16-26/h12-18,20-23,38H,10-11,19,24H2,1-9H3 |
| InChIKey | ASZZVMYHLUFJCP-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|