C29H44ClOP — CID 89356684
chloro-[3-(3,5-ditert-butyl-2-phenylmethoxyphenyl)octan-3-yl]phosphane (PubChem CID 89356684) has the molecular formula C29H44ClOP and a molecular weight of 475.10 g/mol. Its IUPAC name is chloro-[3-(3,5-ditert-butyl-2-phenylmethoxyphenyl)octan-3-yl]phosphane.
| Compound Name | chloro-[3-(3,5-ditert-butyl-2-phenylmethoxyphenyl)octan-3-yl]phosphane |
|---|---|
| PubChem CID | 89356684 |
| Molecular Formula | C29H44ClOP |
| Molecular Weight | 475.10 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | chloro-[3-(3,5-ditert-butyl-2-phenylmethoxyphenyl)octan-3-yl]phosphane |
| SMILES | CCCCCC(CC)(PCl)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H44ClOP/c1-9-11-15-18-29(10-2,32-30)25-20-23(27(3,4)5)19-24(28(6,7)8)26(25)31-21-22-16-13-12-14-17-22/h12-14,16-17,19-20,32H,9-11,15,18,21H2,1-8H3 |
| InChIKey | KISVVSPXKJPEKF-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.10 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|