C34H56NO2P — CID 89356456
1-[2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]-5-methylphenyl]-N,N-dimethylmethanamine (PubChem CID 89356456) has the molecular formula C34H56NO2P and a molecular weight of 541.80 g/mol. Its IUPAC name is 1-[2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]-5-methylphenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]-5-methylphenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 89356456 |
| Molecular Formula | C34H56NO2P |
| Molecular Weight | 541.80 g/mol |
| Exact Mass | 541.40 |
| IUPAC Name | 1-[2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]-5-methylphenyl]-N,N-dimethylmethanamine |
| SMILES | CCCCCC(CC)(Pc1ccc(C)cc1CN(C)C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCOC |
| InChI | InChI=1S/C34H56NO2P/c1-13-15-16-19-34(14-2,38-30-18-17-25(3)20-26(30)23-35(10)11)29-22-27(32(4,5)6)21-28(33(7,8)9)31(29)37-24-36-12/h17-18,20-22,38H,13-16,19,23-24H2,1-12H3 |
| InChIKey | XKFNDYFWWKTBNA-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.80 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|