C36H59OPS — CID 89356331
4-tert-butyl-2-(2,3-dimethyloctan-2-yl)-6-[3-[4-methyl-2-(sulfanylmethyl)phenyl]phosphanyloctan-3-yl]phenol (PubChem CID 89356331) has the molecular formula C36H59OPS and a molecular weight of 570.91 g/mol. Its IUPAC name is 4-tert-butyl-2-(2,3-dimethyloctan-2-yl)-6-[3-[4-methyl-2-(sulfanylmethyl)phenyl]phosphanyloctan-3-yl]phenol.
| Compound Name | 4-tert-butyl-2-(2,3-dimethyloctan-2-yl)-6-[3-[4-methyl-2-(sulfanylmethyl)phenyl]phosphanyloctan-3-yl]phenol |
|---|---|
| PubChem CID | 89356331 |
| Molecular Formula | C36H59OPS |
| Molecular Weight | 570.91 g/mol |
| Exact Mass | 570.40 |
| IUPAC Name | 4-tert-butyl-2-(2,3-dimethyloctan-2-yl)-6-[3-[4-methyl-2-(sulfanylmethyl)phenyl]phosphanyloctan-3-yl]phenol |
| SMILES | CCCCCC(C)C(C)(C)c1cc(C(C)(C)C)cc(C(CC)(CCCCC)Pc2ccc(C)cc2CS)c1O |
| InChI | InChI=1S/C36H59OPS/c1-11-14-16-18-27(5)35(9,10)30-23-29(34(6,7)8)24-31(33(30)37)36(13-3,21-17-15-12-2)38-32-20-19-26(4)22-28(32)25-39/h19-20,22-24,27,37-39H,11-18,21,25H2,1-10H3 |
| InChIKey | LETJNGJMWSTVMG-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.91 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|