C28H43FNOP — CID 71191462
4-tert-butyl-2-[3-[2-[(dimethylamino)methyl]-4-fluorophenyl]phosphanyloctan-3-yl]-6-methylphenol (PubChem CID 71191462) has the molecular formula C28H43FNOP and a molecular weight of 459.63 g/mol. Its IUPAC name is 4-tert-butyl-2-[3-[2-[(dimethylamino)methyl]-4-fluorophenyl]phosphanyloctan-3-yl]-6-methylphenol.
| Compound Name | 4-tert-butyl-2-[3-[2-[(dimethylamino)methyl]-4-fluorophenyl]phosphanyloctan-3-yl]-6-methylphenol |
|---|---|
| PubChem CID | 71191462 |
| Molecular Formula | C28H43FNOP |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 4-tert-butyl-2-[3-[2-[(dimethylamino)methyl]-4-fluorophenyl]phosphanyloctan-3-yl]-6-methylphenol |
| SMILES | CCCCCC(CC)(Pc1ccc(F)cc1CN(C)C)c1cc(C(C)(C)C)cc(C)c1O |
| InChI | InChI=1S/C28H43FNOP/c1-9-11-12-15-28(10-2,24-18-22(27(4,5)6)16-20(3)26(24)31)32-25-14-13-23(29)17-21(25)19-30(7)8/h13-14,16-18,31-32H,9-12,15,19H2,1-8H3 |
| InChIKey | SYWNHKBUEXJYQA-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|