C21H30NOP — CID 71039669
2-[3-[2-[(dimethylamino)methyl]-4-methylphenyl]phosphanylpentan-3-yl]phenol (PubChem CID 71039669) has the molecular formula C21H30NOP and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[3-[2-[(dimethylamino)methyl]-4-methylphenyl]phosphanylpentan-3-yl]phenol.
| Compound Name | 2-[3-[2-[(dimethylamino)methyl]-4-methylphenyl]phosphanylpentan-3-yl]phenol |
|---|---|
| PubChem CID | 71039669 |
| Molecular Formula | C21H30NOP |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-[3-[2-[(dimethylamino)methyl]-4-methylphenyl]phosphanylpentan-3-yl]phenol |
| SMILES | CCC(CC)(Pc1ccc(C)cc1CN(C)C)c1ccccc1O |
| InChI | InChI=1S/C21H30NOP/c1-6-21(7-2,18-10-8-9-11-19(18)23)24-20-13-12-16(3)14-17(20)15-22(4)5/h8-14,23-24H,6-7,15H2,1-5H3 |
| InChIKey | FGUXOESXDDJLFN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|