C21H29OPS — CID 89214335
2-methyl-6-[3-[4-methyl-2-(1-sulfanylethyl)phenyl]phosphanylpentan-3-yl]phenol (PubChem CID 89214335) has the molecular formula C21H29OPS and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-methyl-6-[3-[4-methyl-2-(1-sulfanylethyl)phenyl]phosphanylpentan-3-yl]phenol.
| Compound Name | 2-methyl-6-[3-[4-methyl-2-(1-sulfanylethyl)phenyl]phosphanylpentan-3-yl]phenol |
|---|---|
| PubChem CID | 89214335 |
| Molecular Formula | C21H29OPS |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-methyl-6-[3-[4-methyl-2-(1-sulfanylethyl)phenyl]phosphanylpentan-3-yl]phenol |
| SMILES | CCC(CC)(Pc1ccc(C)cc1C(C)S)c1cccc(C)c1O |
| InChI | InChI=1S/C21H29OPS/c1-6-21(7-2,18-10-8-9-15(4)20(18)22)23-19-12-11-14(3)13-17(19)16(5)24/h8-13,16,22-24H,6-7H2,1-5H3 |
| InChIKey | SLDFZOHPXTVXDJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|