C28H35O3P — CID 71039825
1-[2-[3-(5-methoxy-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-5-methylphenyl]ethanol (PubChem CID 71039825) has the molecular formula C28H35O3P and a molecular weight of 450.56 g/mol. Its IUPAC name is 1-[2-[3-(5-methoxy-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-5-methylphenyl]ethanol.
| Compound Name | 1-[2-[3-(5-methoxy-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-5-methylphenyl]ethanol |
|---|---|
| PubChem CID | 71039825 |
| Molecular Formula | C28H35O3P |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-[2-[3-(5-methoxy-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-5-methylphenyl]ethanol |
| SMILES | CCC(CC)(Pc1ccc(C)cc1C(C)O)c1cc(OC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H35O3P/c1-6-28(7-2,32-27-16-13-20(3)17-24(27)21(4)29)25-18-23(30-5)14-15-26(25)31-19-22-11-9-8-10-12-22/h8-18,21,29,32H,6-7,19H2,1-5H3 |
| InChIKey | LIQPQXAEKKKFBL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|