C28H34NO2P — CID 71191593
1-[2-[3-(5-methoxy-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]phenyl]-N-methylmethanimine (PubChem CID 71191593) has the molecular formula C28H34NO2P and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-[2-[3-(5-methoxy-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]phenyl]-N-methylmethanimine.
| Compound Name | 1-[2-[3-(5-methoxy-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]phenyl]-N-methylmethanimine |
|---|---|
| PubChem CID | 71191593 |
| Molecular Formula | C28H34NO2P |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-[2-[3-(5-methoxy-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]phenyl]-N-methylmethanimine |
| SMILES | CCCC(CC)(Pc1ccccc1/C=N\C)c1cc(OC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H34NO2P/c1-5-18-28(6-2,32-27-15-11-10-14-23(27)20-29-3)25-19-24(30-4)16-17-26(25)31-21-22-12-8-7-9-13-22/h7-17,19-20,32H,5-6,18,21H2,1-4H3/b29-20- |
| InChIKey | HXRRLEUFGREDIG-BRPDVVIDSA-N |
| XLogP | 6.73 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|